C16H22BrN3O3 — CID 120783894
2-amino-N-[2-(2-bromoanilino)-2-oxoethyl]-N-methyl-2-(oxan-4-yl)acetamide (PubChem CID 120783894) has the molecular formula C16H22BrN3O3 and a molecular weight of 384.27 g/mol. Its IUPAC name is 2-amino-N-[2-(2-bromoanilino)-2-oxoethyl]-N-methyl-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-[2-(2-bromoanilino)-2-oxoethyl]-N-methyl-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120783894 |
| Molecular Formula | C16H22BrN3O3 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2-amino-N-[2-(2-bromoanilino)-2-oxoethyl]-N-methyl-2-(oxan-4-yl)acetamide |
| SMILES | CN(CC(=O)Nc1ccccc1Br)C(=O)C(N)C1CCOCC1 |
| InChI | InChI=1S/C16H22BrN3O3/c1-20(16(22)15(18)11-6-8-23-9-7-11)10-14(21)19-13-5-3-2-4-12(13)17/h2-5,11,15H,6-10,18H2,1H3,(H,19,21) |
| InChIKey | KDAHNCCNEXRFKE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |