C17H25N3O3 — CID 120794368
2-amino-N-[2-(benzylamino)-2-oxoethyl]-N-methyl-2-(oxan-4-yl)acetamide (PubChem CID 120794368) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-amino-N-[2-(benzylamino)-2-oxoethyl]-N-methyl-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-[2-(benzylamino)-2-oxoethyl]-N-methyl-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120794368 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 2-amino-N-[2-(benzylamino)-2-oxoethyl]-N-methyl-2-(oxan-4-yl)acetamide |
| SMILES | CN(CC(=O)NCc1ccccc1)C(=O)C(N)C1CCOCC1 |
| InChI | InChI=1S/C17H25N3O3/c1-20(17(22)16(18)14-7-9-23-10-8-14)12-15(21)19-11-13-5-3-2-4-6-13/h2-6,14,16H,7-12,18H2,1H3,(H,19,21) |
| InChIKey | CUQCONYEODTDIN-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |