C20H23N3O3 — CID 120789036
(2S,5R)-5-(aminomethyl)-N-(3-benzamido-2-methylphenyl)oxolane-2-carboxamide (PubChem CID 120789036) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-(3-benzamido-2-methylphenyl)oxolane-2-carboxamide.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-(3-benzamido-2-methylphenyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 120789036 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-(3-benzamido-2-methylphenyl)oxolane-2-carboxamide |
| SMILES | Cc1c(NC(=O)c2ccccc2)cccc1NC(=O)[C@@H]1CC[C@H](CN)O1 |
| InChI | InChI=1S/C20H23N3O3/c1-13-16(22-19(24)14-6-3-2-4-7-14)8-5-9-17(13)23-20(25)18-11-10-15(12-21)26-18/h2-9,15,18H,10-12,21H2,1H3,(H,22,24)(H,23,25)/t15-,18+/m1/s1 |
| InChIKey | BCOAPHRBSKTOPT-QAPCUYQASA-N |
| XLogP | 2.69 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |