C12H16N2O3 — CID 120801756
(2S,5R)-5-(aminomethyl)-N-(2-hydroxyphenyl)oxolane-2-carboxamide (PubChem CID 120801756) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-(2-hydroxyphenyl)oxolane-2-carboxamide.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-(2-hydroxyphenyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 120801756 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-(2-hydroxyphenyl)oxolane-2-carboxamide |
| SMILES | NC[C@H]1CC[C@@H](C(=O)Nc2ccccc2O)O1 |
| InChI | InChI=1S/C12H16N2O3/c13-7-8-5-6-11(17-8)12(16)14-9-3-1-2-4-10(9)15/h1-4,8,11,15H,5-7,13H2,(H,14,16)/t8-,11+/m1/s1 |
| InChIKey | DTWMAAWFGAJLNS-KCJUWKMLSA-N |
| XLogP | 0.84 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|