C21H27ClN2O3 — CID 120791363
2-amino-2-(oxan-4-yl)-N-[1-(2-phenoxyphenyl)ethyl]acetamide;hydrochloride (PubChem CID 120791363) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is 2-amino-2-(oxan-4-yl)-N-[1-(2-phenoxyphenyl)ethyl]acetamide;hydrochloride.
| Compound Name | 2-amino-2-(oxan-4-yl)-N-[1-(2-phenoxyphenyl)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120791363 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-amino-2-(oxan-4-yl)-N-[1-(2-phenoxyphenyl)ethyl]acetamide;hydrochloride |
| SMILES | CC(NC(=O)C(N)C1CCOCC1)c1ccccc1Oc1ccccc1.Cl |
| InChI | InChI=1S/C21H26N2O3.ClH/c1-15(23-21(24)20(22)16-11-13-25-14-12-16)18-9-5-6-10-19(18)26-17-7-3-2-4-8-17;/h2-10,15-16,20H,11-14,22H2,1H3,(H,23,24);1H |
| InChIKey | UUTGSYAKKICGNM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |