C20H22ClF3N2O3 — CID 120790257
2-amino-2-(oxan-4-yl)-N-[4-[2-(trifluoromethyl)phenoxy]phenyl]acetamide;hydrochloride (PubChem CID 120790257) has the molecular formula C20H22ClF3N2O3 and a molecular weight of 430.85 g/mol. Its IUPAC name is 2-amino-2-(oxan-4-yl)-N-[4-[2-(trifluoromethyl)phenoxy]phenyl]acetamide;hydrochloride.
| Compound Name | 2-amino-2-(oxan-4-yl)-N-[4-[2-(trifluoromethyl)phenoxy]phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120790257 |
| Molecular Formula | C20H22ClF3N2O3 |
| Molecular Weight | 430.85 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 2-amino-2-(oxan-4-yl)-N-[4-[2-(trifluoromethyl)phenoxy]phenyl]acetamide;hydrochloride |
| SMILES | Cl.NC(C(=O)Nc1ccc(Oc2ccccc2C(F)(F)F)cc1)C1CCOCC1 |
| InChI | InChI=1S/C20H21F3N2O3.ClH/c21-20(22,23)16-3-1-2-4-17(16)28-15-7-5-14(6-8-15)25-19(26)18(24)13-9-11-27-12-10-13;/h1-8,13,18H,9-12,24H2,(H,25,26);1H |
| InChIKey | NTJSCWBMPKKBBL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.85 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |