C17H23N5O2 — CID 120793438
2-amino-N-[3-[(1-methylpyrazol-4-yl)amino]phenyl]-2-(oxan-4-yl)acetamide (PubChem CID 120793438) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-amino-N-[3-[(1-methylpyrazol-4-yl)amino]phenyl]-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-[3-[(1-methylpyrazol-4-yl)amino]phenyl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120793438 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 2-amino-N-[3-[(1-methylpyrazol-4-yl)amino]phenyl]-2-(oxan-4-yl)acetamide |
| SMILES | Cn1cc(Nc2cccc(NC(=O)C(N)C3CCOCC3)c2)cn1 |
| InChI | InChI=1S/C17H23N5O2/c1-22-11-15(10-19-22)20-13-3-2-4-14(9-13)21-17(23)16(18)12-5-7-24-8-6-12/h2-4,9-12,16,20H,5-8,18H2,1H3,(H,21,23) |
| InChIKey | CUDPRCHZZBQAON-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |