C21H35ClN2O3 — CID 120795659
2-amino-N-[[4-methyl-2-(4-methylpentoxy)phenyl]methyl]-2-(oxan-4-yl)acetamide;hydrochloride (PubChem CID 120795659) has the molecular formula C21H35ClN2O3 and a molecular weight of 398.98 g/mol. Its IUPAC name is 2-amino-N-[[4-methyl-2-(4-methylpentoxy)phenyl]methyl]-2-(oxan-4-yl)acetamide;hydrochloride.
| Compound Name | 2-amino-N-[[4-methyl-2-(4-methylpentoxy)phenyl]methyl]-2-(oxan-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120795659 |
| Molecular Formula | C21H35ClN2O3 |
| Molecular Weight | 398.98 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 2-amino-N-[[4-methyl-2-(4-methylpentoxy)phenyl]methyl]-2-(oxan-4-yl)acetamide;hydrochloride |
| SMILES | Cc1ccc(CNC(=O)C(N)C2CCOCC2)c(OCCCC(C)C)c1.Cl |
| InChI | InChI=1S/C21H34N2O3.ClH/c1-15(2)5-4-10-26-19-13-16(3)6-7-18(19)14-23-21(24)20(22)17-8-11-25-12-9-17;/h6-7,13,15,17,20H,4-5,8-12,14,22H2,1-3H3,(H,23,24);1H |
| InChIKey | CWIYAATZLGJASS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.98 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|