C20H30N2O4 — CID 120795652
2-amino-N-[[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]methyl]-2-(oxan-4-yl)acetamide (PubChem CID 120795652) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-amino-N-[[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]methyl]-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-[[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]methyl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120795652 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 2-amino-N-[[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]methyl]-2-(oxan-4-yl)acetamide |
| SMILES | Cc1ccc(CNC(=O)C(N)C2CCOCC2)c(OCC2CCCO2)c1 |
| InChI | InChI=1S/C20H30N2O4/c1-14-4-5-16(18(11-14)26-13-17-3-2-8-25-17)12-22-20(23)19(21)15-6-9-24-10-7-15/h4-5,11,15,17,19H,2-3,6-10,12-13,21H2,1H3,(H,22,23) |
| InChIKey | OJDKUKGBTTUZEH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |