C19H25NO5 — CID 120977012
2-[[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]methylcarbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 120977012) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is 2-[[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]methylcarbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]methylcarbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120977012 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-[[4-methyl-2-(oxolan-2-ylmethoxy)phenyl]methylcarbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | Cc1ccc(CNC(=O)C2CCC2C(=O)O)c(OCC2CCCO2)c1 |
| InChI | InChI=1S/C19H25NO5/c1-12-4-5-13(17(9-12)25-11-14-3-2-8-24-14)10-20-18(21)15-6-7-16(15)19(22)23/h4-5,9,14-16H,2-3,6-8,10-11H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | DEOKPJCMBWDBJA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |