C19H22Cl2N2O2S — CID 120795787
2-amino-N-[3-(4-chlorophenyl)sulfanylphenyl]-2-(oxan-4-yl)acetamide;hydrochloride (PubChem CID 120795787) has the molecular formula C19H22Cl2N2O2S and a molecular weight of 413.37 g/mol. Its IUPAC name is 2-amino-N-[3-(4-chlorophenyl)sulfanylphenyl]-2-(oxan-4-yl)acetamide;hydrochloride.
| Compound Name | 2-amino-N-[3-(4-chlorophenyl)sulfanylphenyl]-2-(oxan-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120795787 |
| Molecular Formula | C19H22Cl2N2O2S |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 2-amino-N-[3-(4-chlorophenyl)sulfanylphenyl]-2-(oxan-4-yl)acetamide;hydrochloride |
| SMILES | Cl.NC(C(=O)Nc1cccc(Sc2ccc(Cl)cc2)c1)C1CCOCC1 |
| InChI | InChI=1S/C19H21ClN2O2S.ClH/c20-14-4-6-16(7-5-14)25-17-3-1-2-15(12-17)22-19(23)18(21)13-8-10-24-11-9-13;/h1-7,12-13,18H,8-11,21H2,(H,22,23);1H |
| InChIKey | URCGBUHVWVRADH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |