C17H16N4O4 — CID 1207988
(E)-2-cyano-N-(4,6-dimethoxypyrimidin-2-yl)-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 1207988) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is (E)-2-cyano-N-(4,6-dimethoxypyrimidin-2-yl)-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(4,6-dimethoxypyrimidin-2-yl)-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1207988 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (E)-2-cyano-N-(4,6-dimethoxypyrimidin-2-yl)-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C(\C#N)C(=O)Nc2nc(OC)cc(OC)n2)cc1 |
| InChI | InChI=1S/C17H16N4O4/c1-23-13-6-4-11(5-7-13)8-12(10-18)16(22)21-17-19-14(24-2)9-15(20-17)25-3/h4-9H,1-3H3,(H,19,20,21,22)/b12-8+ |
| InChIKey | QYSYWMZYLDBFBQ-XYOKQWHBSA-N |
| XLogP | 2.05 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|