C10H4N2O2S2 — CID 1207990
[1,4]dithiino[2,3-b]quinoxaline-2,3-dione (PubChem CID 1207990) has the molecular formula C10H4N2O2S2 and a molecular weight of 248.29 g/mol. Its IUPAC name is [1,4]dithiino[2,3-b]quinoxaline-2,3-dione.
| Compound Name | [1,4]dithiino[2,3-b]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 1207990 |
| Molecular Formula | C10H4N2O2S2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | [1,4]dithiino[2,3-b]quinoxaline-2,3-dione |
| SMILES | O=c1sc2nc3ccccc3nc2sc1=O |
| InChI | InChI=1S/C10H4N2O2S2/c13-9-10(14)16-8-7(15-9)11-5-3-1-2-4-6(5)12-8/h1-4H |
| InChIKey | HTXHXTTUFZLBBB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|