C20H24F3N3O — CID 120813563
2-naphthalen-2-yl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide (PubChem CID 120813563) has the molecular formula C20H24F3N3O and a molecular weight of 379.43 g/mol. Its IUPAC name is 2-naphthalen-2-yl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide.
| Compound Name | 2-naphthalen-2-yl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 120813563 |
| Molecular Formula | C20H24F3N3O |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-naphthalen-2-yl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide |
| SMILES | CC(C(=O)NCC(N1CCNCC1)C(F)(F)F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H24F3N3O/c1-14(16-7-6-15-4-2-3-5-17(15)12-16)19(27)25-13-18(20(21,22)23)26-10-8-24-9-11-26/h2-7,12,14,18,24H,8-11,13H2,1H3,(H,25,27) |
| InChIKey | FKFWWCDFVAIGOD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |