C18H24N4O2 — CID 120815195
1-[3-(4-amino-3,3-dimethylpiperidin-1-yl)-3-oxopropyl]cinnolin-4-one (PubChem CID 120815195) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-[3-(4-amino-3,3-dimethylpiperidin-1-yl)-3-oxopropyl]cinnolin-4-one.
| Compound Name | 1-[3-(4-amino-3,3-dimethylpiperidin-1-yl)-3-oxopropyl]cinnolin-4-one |
|---|---|
| PubChem CID | 120815195 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 1-[3-(4-amino-3,3-dimethylpiperidin-1-yl)-3-oxopropyl]cinnolin-4-one |
| SMILES | CC1(C)CN(C(=O)CCn2ncc(=O)c3ccccc32)CCC1N |
| InChI | InChI=1S/C18H24N4O2/c1-18(2)12-21(9-7-16(18)19)17(24)8-10-22-14-6-4-3-5-13(14)15(23)11-20-22/h3-6,11,16H,7-10,12,19H2,1-2H3 |
| InChIKey | QRZKKBUZYAQFSZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |