C18H21N3O3 — CID 94643325
1-[3-[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-3-oxopropyl]cinnolin-4-one (PubChem CID 94643325) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-[3-[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-3-oxopropyl]cinnolin-4-one.
| Compound Name | 1-[3-[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-3-oxopropyl]cinnolin-4-one |
|---|---|
| PubChem CID | 94643325 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-[3-[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-3-oxopropyl]cinnolin-4-one |
| SMILES | O=C(CCn1ncc(=O)c2ccccc21)N1CCO[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C18H21N3O3/c22-16-12-19-21(14-5-2-1-4-13(14)16)9-8-18(23)20-10-11-24-17-7-3-6-15(17)20/h1-2,4-5,12,15,17H,3,6-11H2/t15-,17+/m0/s1 |
| InChIKey | VGGQDWBHRMTWDU-DOTOQJQBSA-N |
| XLogP | 1.57 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |