C18H22N2O2 — CID 129370161
1-[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-(1-methylindol-3-yl)ethanone (PubChem CID 129370161) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-(1-methylindol-3-yl)ethanone.
| Compound Name | 1-[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-(1-methylindol-3-yl)ethanone |
|---|---|
| PubChem CID | 129370161 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-(1-methylindol-3-yl)ethanone |
| SMILES | Cn1cc(CC(=O)N2CCO[C@@H]3CCC[C@@H]32)c2ccccc21 |
| InChI | InChI=1S/C18H22N2O2/c1-19-12-13(14-5-2-3-6-15(14)19)11-18(21)20-9-10-22-17-8-4-7-16(17)20/h2-3,5-6,12,16-17H,4,7-11H2,1H3/t16-,17+/m0/s1 |
| InChIKey | KMURMDMFIQFUCG-DLBZAZTESA-N |
| XLogP | 2.50 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |