C20H24N2O2 — CID 95581661
1-[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-(2,4-dimethylquinolin-3-yl)ethanone (PubChem CID 95581661) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-(2,4-dimethylquinolin-3-yl)ethanone.
| Compound Name | 1-[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-(2,4-dimethylquinolin-3-yl)ethanone |
|---|---|
| PubChem CID | 95581661 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1-[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-(2,4-dimethylquinolin-3-yl)ethanone |
| SMILES | Cc1nc2ccccc2c(C)c1CC(=O)N1CCO[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C20H24N2O2/c1-13-15-6-3-4-7-17(15)21-14(2)16(13)12-20(23)22-10-11-24-19-9-5-8-18(19)22/h3-4,6-7,18-19H,5,8-12H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | YMABBIVEYLMCEL-RBUKOAKNSA-N |
| XLogP | 3.17 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |