C18H23N3O — CID 119415901
1-(1,4-diazepan-1-yl)-2-(2,4-dimethylquinolin-3-yl)ethanone (PubChem CID 119415901) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)-2-(2,4-dimethylquinolin-3-yl)ethanone.
| Compound Name | 1-(1,4-diazepan-1-yl)-2-(2,4-dimethylquinolin-3-yl)ethanone |
|---|---|
| PubChem CID | 119415901 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)-2-(2,4-dimethylquinolin-3-yl)ethanone |
| SMILES | Cc1nc2ccccc2c(C)c1CC(=O)N1CCCNCC1 |
| InChI | InChI=1S/C18H23N3O/c1-13-15-6-3-4-7-17(15)20-14(2)16(13)12-18(22)21-10-5-8-19-9-11-21/h3-4,6-7,19H,5,8-12H2,1-2H3 |
| InChIKey | JZHIKOIHCDYNGJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |