C18H26ClN3O2 — CID 120816986
N-[4-(4-amino-3,3-dimethylpiperidin-1-yl)-4-oxobutyl]-4-chlorobenzamide (PubChem CID 120816986) has the molecular formula C18H26ClN3O2 and a molecular weight of 351.88 g/mol. Its IUPAC name is N-[4-(4-amino-3,3-dimethylpiperidin-1-yl)-4-oxobutyl]-4-chlorobenzamide.
| Compound Name | N-[4-(4-amino-3,3-dimethylpiperidin-1-yl)-4-oxobutyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 120816986 |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-[4-(4-amino-3,3-dimethylpiperidin-1-yl)-4-oxobutyl]-4-chlorobenzamide |
| SMILES | CC1(C)CN(C(=O)CCCNC(=O)c2ccc(Cl)cc2)CCC1N |
| InChI | InChI=1S/C18H26ClN3O2/c1-18(2)12-22(11-9-15(18)20)16(23)4-3-10-21-17(24)13-5-7-14(19)8-6-13/h5-8,15H,3-4,9-12,20H2,1-2H3,(H,21,24) |
| InChIKey | GPCLSRBEGCNBON-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|