C18H26ClN3O4S — CID 48734491
4-chloro-N-[4-[4-[methyl(methylsulfonyl)amino]piperidin-1-yl]-4-oxobutyl]benzamide (PubChem CID 48734491) has the molecular formula C18H26ClN3O4S and a molecular weight of 415.94 g/mol. Its IUPAC name is 4-chloro-N-[4-[4-[methyl(methylsulfonyl)amino]piperidin-1-yl]-4-oxobutyl]benzamide.
| Compound Name | 4-chloro-N-[4-[4-[methyl(methylsulfonyl)amino]piperidin-1-yl]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 48734491 |
| Molecular Formula | C18H26ClN3O4S |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 4-chloro-N-[4-[4-[methyl(methylsulfonyl)amino]piperidin-1-yl]-4-oxobutyl]benzamide |
| SMILES | CN(C1CCN(C(=O)CCCNC(=O)c2ccc(Cl)cc2)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C18H26ClN3O4S/c1-21(27(2,25)26)16-9-12-22(13-10-16)17(23)4-3-11-20-18(24)14-5-7-15(19)8-6-14/h5-8,16H,3-4,9-13H2,1-2H3,(H,20,24) |
| InChIKey | VOQAGIIHLOKHFI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|