C21H30N2O5 — CID 120821324
5-[4-(3-cyclohexylpropanoyl)piperazine-1-carbonyl]-2-ethylfuran-3-carboxylic acid (PubChem CID 120821324) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is 5-[4-(3-cyclohexylpropanoyl)piperazine-1-carbonyl]-2-ethylfuran-3-carboxylic acid.
| Compound Name | 5-[4-(3-cyclohexylpropanoyl)piperazine-1-carbonyl]-2-ethylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 120821324 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 5-[4-(3-cyclohexylpropanoyl)piperazine-1-carbonyl]-2-ethylfuran-3-carboxylic acid |
| SMILES | CCc1oc(C(=O)N2CCN(C(=O)CCC3CCCCC3)CC2)cc1C(=O)O |
| InChI | InChI=1S/C21H30N2O5/c1-2-17-16(21(26)27)14-18(28-17)20(25)23-12-10-22(11-13-23)19(24)9-8-15-6-4-3-5-7-15/h14-15H,2-13H2,1H3,(H,26,27) |
| InChIKey | DKELWWLAFLEOQX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |