C17H24N2O5 — CID 120821552
5-[3-(butanoylamino)piperidine-1-carbonyl]-2-ethylfuran-3-carboxylic acid (PubChem CID 120821552) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 5-[3-(butanoylamino)piperidine-1-carbonyl]-2-ethylfuran-3-carboxylic acid.
| Compound Name | 5-[3-(butanoylamino)piperidine-1-carbonyl]-2-ethylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 120821552 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 5-[3-(butanoylamino)piperidine-1-carbonyl]-2-ethylfuran-3-carboxylic acid |
| SMILES | CCCC(=O)NC1CCCN(C(=O)c2cc(C(=O)O)c(CC)o2)C1 |
| InChI | InChI=1S/C17H24N2O5/c1-3-6-15(20)18-11-7-5-8-19(10-11)16(21)14-9-12(17(22)23)13(4-2)24-14/h9,11H,3-8,10H2,1-2H3,(H,18,20)(H,22,23) |
| InChIKey | DLPWDXHJSGFLOJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |