C18H27N5 — CID 120822858
1-tert-butyl-2-[(1-cyclopropyl-2-ethylbenzimidazol-5-yl)methyl]guanidine (PubChem CID 120822858) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is 1-tert-butyl-2-[(1-cyclopropyl-2-ethylbenzimidazol-5-yl)methyl]guanidine.
| Compound Name | 1-tert-butyl-2-[(1-cyclopropyl-2-ethylbenzimidazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 120822858 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 1-tert-butyl-2-[(1-cyclopropyl-2-ethylbenzimidazol-5-yl)methyl]guanidine |
| SMILES | CCc1nc2cc(C/N=C(\N)NC(C)(C)C)ccc2n1C1CC1 |
| InChI | InChI=1S/C18H27N5/c1-5-16-21-14-10-12(11-20-17(19)22-18(2,3)4)6-9-15(14)23(16)13-7-8-13/h6,9-10,13H,5,7-8,11H2,1-4H3,(H3,19,20,22) |
| InChIKey | WGTNQAKIOJZDEI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|