C12H17Cl2FN4O — CID 120829118
6-fluoro-N-[2-(methylamino)propyl]-1H-benzimidazole-4-carboxamide;dihydrochloride (PubChem CID 120829118) has the molecular formula C12H17Cl2FN4O and a molecular weight of 323.20 g/mol. Its IUPAC name is 6-fluoro-N-[2-(methylamino)propyl]-1H-benzimidazole-4-carboxamide;dihydrochloride.
| Compound Name | 6-fluoro-N-[2-(methylamino)propyl]-1H-benzimidazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120829118 |
| Molecular Formula | C12H17Cl2FN4O |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 6-fluoro-N-[2-(methylamino)propyl]-1H-benzimidazole-4-carboxamide;dihydrochloride |
| SMILES | CNC(C)CNC(=O)c1cc(F)cc2[nH]cnc12.Cl.Cl |
| InChI | InChI=1S/C12H15FN4O.2ClH/c1-7(14-2)5-15-12(18)9-3-8(13)4-10-11(9)17-6-16-10;;/h3-4,6-7,14H,5H2,1-2H3,(H,15,18)(H,16,17);2*1H |
| InChIKey | KXYBIHACRIOSHU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |