C14H21Cl2FN4O — CID 119585412
N-(1-amino-4-methylpentan-2-yl)-6-fluoro-1H-benzimidazole-4-carboxamide;dihydrochloride (PubChem CID 119585412) has the molecular formula C14H21Cl2FN4O and a molecular weight of 351.25 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-6-fluoro-1H-benzimidazole-4-carboxamide;dihydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-6-fluoro-1H-benzimidazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119585412 |
| Molecular Formula | C14H21Cl2FN4O |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-6-fluoro-1H-benzimidazole-4-carboxamide;dihydrochloride |
| SMILES | CC(C)CC(CN)NC(=O)c1cc(F)cc2[nH]cnc12.Cl.Cl |
| InChI | InChI=1S/C14H19FN4O.2ClH/c1-8(2)3-10(6-16)19-14(20)11-4-9(15)5-12-13(11)18-7-17-12;;/h4-5,7-8,10H,3,6,16H2,1-2H3,(H,17,18)(H,19,20);2*1H |
| InChIKey | XDOGWZOGFKCQGE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |