C14H19Cl2FN4O — CID 119564817
N-[1-(aminomethyl)cyclopentyl]-6-fluoro-1H-benzimidazole-4-carboxamide;dihydrochloride (PubChem CID 119564817) has the molecular formula C14H19Cl2FN4O and a molecular weight of 349.24 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclopentyl]-6-fluoro-1H-benzimidazole-4-carboxamide;dihydrochloride.
| Compound Name | N-[1-(aminomethyl)cyclopentyl]-6-fluoro-1H-benzimidazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119564817 |
| Molecular Formula | C14H19Cl2FN4O |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | N-[1-(aminomethyl)cyclopentyl]-6-fluoro-1H-benzimidazole-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCC1(NC(=O)c2cc(F)cc3[nH]cnc23)CCCC1 |
| InChI | InChI=1S/C14H17FN4O.2ClH/c15-9-5-10(12-11(6-9)17-8-18-12)13(20)19-14(7-16)3-1-2-4-14;;/h5-6,8H,1-4,7,16H2,(H,17,18)(H,19,20);2*1H |
| InChIKey | KQOIQRLZFNHZBF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |