C16H18FN3O2 — CID 119566050
N-[1-(aminomethyl)cyclopentyl]-7-fluoro-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 119566050) has the molecular formula C16H18FN3O2 and a molecular weight of 303.34 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclopentyl]-7-fluoro-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-[1-(aminomethyl)cyclopentyl]-7-fluoro-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 119566050 |
| Molecular Formula | C16H18FN3O2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-[1-(aminomethyl)cyclopentyl]-7-fluoro-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | NCC1(NC(=O)c2cc(=O)[nH]c3cc(F)ccc23)CCCC1 |
| InChI | InChI=1S/C16H18FN3O2/c17-10-3-4-11-12(8-14(21)19-13(11)7-10)15(22)20-16(9-18)5-1-2-6-16/h3-4,7-8H,1-2,5-6,9,18H2,(H,19,21)(H,20,22) |
| InChIKey | LCAYEUZCNZPOSI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |