C16H18N2O3 — CID 62517694
N-[1-(hydroxymethyl)cyclopentyl]-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 62517694) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)cyclopentyl]-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-[1-(hydroxymethyl)cyclopentyl]-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 62517694 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-[1-(hydroxymethyl)cyclopentyl]-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | O=C(NC1(CO)CCCC1)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C16H18N2O3/c19-10-16(7-3-4-8-16)18-15(21)12-9-14(20)17-13-6-2-1-5-11(12)13/h1-2,5-6,9,19H,3-4,7-8,10H2,(H,17,20)(H,18,21) |
| InChIKey | MHGXGSUNCJJNIT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |