C16H18ClN3O2S — CID 120829265
2-[(2-chlorobenzoyl)amino]-N-[2-(methylamino)propyl]thiophene-3-carboxamide (PubChem CID 120829265) has the molecular formula C16H18ClN3O2S and a molecular weight of 351.86 g/mol. Its IUPAC name is 2-[(2-chlorobenzoyl)amino]-N-[2-(methylamino)propyl]thiophene-3-carboxamide.
| Compound Name | 2-[(2-chlorobenzoyl)amino]-N-[2-(methylamino)propyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 120829265 |
| Molecular Formula | C16H18ClN3O2S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-[(2-chlorobenzoyl)amino]-N-[2-(methylamino)propyl]thiophene-3-carboxamide |
| SMILES | CNC(C)CNC(=O)c1ccsc1NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H18ClN3O2S/c1-10(18-2)9-19-14(21)12-7-8-23-16(12)20-15(22)11-5-3-4-6-13(11)17/h3-8,10,18H,9H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | JVQYIZKHTFWPSN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |