C13H20ClN3O4S — CID 120830990
4-methoxy-N-[2-(methylamino)propyl]-5-methylsulfanyl-2-nitrobenzamide;hydrochloride (PubChem CID 120830990) has the molecular formula C13H20ClN3O4S and a molecular weight of 349.84 g/mol. Its IUPAC name is 4-methoxy-N-[2-(methylamino)propyl]-5-methylsulfanyl-2-nitrobenzamide;hydrochloride.
| Compound Name | 4-methoxy-N-[2-(methylamino)propyl]-5-methylsulfanyl-2-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 120830990 |
| Molecular Formula | C13H20ClN3O4S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 4-methoxy-N-[2-(methylamino)propyl]-5-methylsulfanyl-2-nitrobenzamide;hydrochloride |
| SMILES | CNC(C)CNC(=O)c1cc(SC)c(OC)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C13H19N3O4S.ClH/c1-8(14-2)7-15-13(17)9-5-12(21-4)11(20-3)6-10(9)16(18)19;/h5-6,8,14H,7H2,1-4H3,(H,15,17);1H |
| InChIKey | KEMYFSYFVSUJFO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|