C20H25F3N4 — CID 120835059
4-pyrrolidin-2-yl-1-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methyl]piperidine (PubChem CID 120835059) has the molecular formula C20H25F3N4 and a molecular weight of 378.44 g/mol. Its IUPAC name is 4-pyrrolidin-2-yl-1-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methyl]piperidine.
| Compound Name | 4-pyrrolidin-2-yl-1-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methyl]piperidine |
|---|---|
| PubChem CID | 120835059 |
| Molecular Formula | C20H25F3N4 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 4-pyrrolidin-2-yl-1-[[5-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]methyl]piperidine |
| SMILES | FC(F)(F)c1ccc(-c2[nH]ncc2CN2CCC(C3CCCN3)CC2)cc1 |
| InChI | InChI=1S/C20H25F3N4/c21-20(22,23)17-5-3-15(4-6-17)19-16(12-25-26-19)13-27-10-7-14(8-11-27)18-2-1-9-24-18/h3-6,12,14,18,24H,1-2,7-11,13H2,(H,25,26) |
| InChIKey | NBQNSOLODRYQSU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |