C14H21ClF2N2 — CID 120836624
[1-[[4-(difluoromethyl)phenyl]methyl]piperidin-3-yl]methanamine;hydrochloride (PubChem CID 120836624) has the molecular formula C14H21ClF2N2 and a molecular weight of 290.78 g/mol. Its IUPAC name is [1-[[4-(difluoromethyl)phenyl]methyl]piperidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-[[4-(difluoromethyl)phenyl]methyl]piperidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120836624 |
| Molecular Formula | C14H21ClF2N2 |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | [1-[[4-(difluoromethyl)phenyl]methyl]piperidin-3-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCCN(Cc2ccc(C(F)F)cc2)C1 |
| InChI | InChI=1S/C14H20F2N2.ClH/c15-14(16)13-5-3-11(4-6-13)9-18-7-1-2-12(8-17)10-18;/h3-6,12,14H,1-2,7-10,17H2;1H |
| InChIKey | MPUMLLVZHCXOQI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |