C14H20ClN3 — CID 66569597
4-[[3-(aminomethyl)piperidin-1-yl]methyl]benzonitrile;hydrochloride (PubChem CID 66569597) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is 4-[[3-(aminomethyl)piperidin-1-yl]methyl]benzonitrile;hydrochloride.
| Compound Name | 4-[[3-(aminomethyl)piperidin-1-yl]methyl]benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 66569597 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 4-[[3-(aminomethyl)piperidin-1-yl]methyl]benzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1ccc(CN2CCCC(CN)C2)cc1 |
| InChI | InChI=1S/C14H19N3.ClH/c15-8-12-3-5-13(6-4-12)10-17-7-1-2-14(9-16)11-17;/h3-6,14H,1-2,7,9-11,16H2;1H |
| InChIKey | DUPZAPMQMOJGBE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |