C19H26N4 — CID 120836846
5-[[3-(aminomethyl)piperidin-1-yl]methyl]-N-methyl-N-phenylpyridin-2-amine (PubChem CID 120836846) has the molecular formula C19H26N4 and a molecular weight of 310.44 g/mol. Its IUPAC name is 5-[[3-(aminomethyl)piperidin-1-yl]methyl]-N-methyl-N-phenylpyridin-2-amine.
| Compound Name | 5-[[3-(aminomethyl)piperidin-1-yl]methyl]-N-methyl-N-phenylpyridin-2-amine |
|---|---|
| PubChem CID | 120836846 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 5-[[3-(aminomethyl)piperidin-1-yl]methyl]-N-methyl-N-phenylpyridin-2-amine |
| SMILES | CN(c1ccccc1)c1ccc(CN2CCCC(CN)C2)cn1 |
| InChI | InChI=1S/C19H26N4/c1-22(18-7-3-2-4-8-18)19-10-9-17(13-21-19)15-23-11-5-6-16(12-20)14-23/h2-4,7-10,13,16H,5-6,11-12,14-15,20H2,1H3 |
| InChIKey | QFJHPPLFFYBOEV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |