C12H18BrN3 — CID 97165519
[(3R)-1-[(6-bromo-3-pyridinyl)methyl]piperidin-3-yl]methanamine (PubChem CID 97165519) has the molecular formula C12H18BrN3 and a molecular weight of 284.20 g/mol. Its IUPAC name is [(3R)-1-[(6-bromo-3-pyridinyl)methyl]piperidin-3-yl]methanamine.
| Compound Name | [(3R)-1-[(6-bromo-3-pyridinyl)methyl]piperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 97165519 |
| Molecular Formula | C12H18BrN3 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | [(3R)-1-[(6-bromo-3-pyridinyl)methyl]piperidin-3-yl]methanamine |
| SMILES | NC[C@H]1CCCN(Cc2ccc(Br)nc2)C1 |
| InChI | InChI=1S/C12H18BrN3/c13-12-4-3-11(7-15-12)9-16-5-1-2-10(6-14)8-16/h3-4,7,10H,1-2,5-6,8-9,14H2/t10-/m1/s1 |
| InChIKey | NVZSNVNZKMKMPR-SNVBAGLBSA-N |
| XLogP | 2.01 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|