C19H27N5O2 — CID 120837260
N-(2-aminoethyl)-1-[[2-(2-methoxyphenyl)pyrazol-3-yl]methyl]piperidine-3-carboxamide (PubChem CID 120837260) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[[2-(2-methoxyphenyl)pyrazol-3-yl]methyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[[2-(2-methoxyphenyl)pyrazol-3-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 120837260 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | N-(2-aminoethyl)-1-[[2-(2-methoxyphenyl)pyrazol-3-yl]methyl]piperidine-3-carboxamide |
| SMILES | COc1ccccc1-n1nccc1CN1CCCC(C(=O)NCCN)C1 |
| InChI | InChI=1S/C19H27N5O2/c1-26-18-7-3-2-6-17(18)24-16(8-10-22-24)14-23-12-4-5-15(13-23)19(25)21-11-9-20/h2-3,6-8,10,15H,4-5,9,11-14,20H2,1H3,(H,21,25) |
| InChIKey | SGQLRBRKDDPZKE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |