C18H25ClN4 — CID 120839419
N-methyl-5-[[(2R)-2-methylpiperazin-1-yl]methyl]-N-phenylpyridin-2-amine;hydrochloride (PubChem CID 120839419) has the molecular formula C18H25ClN4 and a molecular weight of 332.88 g/mol. Its IUPAC name is N-methyl-5-[[(2R)-2-methylpiperazin-1-yl]methyl]-N-phenylpyridin-2-amine;hydrochloride.
| Compound Name | N-methyl-5-[[(2R)-2-methylpiperazin-1-yl]methyl]-N-phenylpyridin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 120839419 |
| Molecular Formula | C18H25ClN4 |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | N-methyl-5-[[(2R)-2-methylpiperazin-1-yl]methyl]-N-phenylpyridin-2-amine;hydrochloride |
| SMILES | C[C@@H]1CNCCN1Cc1ccc(N(C)c2ccccc2)nc1.Cl |
| InChI | InChI=1S/C18H24N4.ClH/c1-15-12-19-10-11-22(15)14-16-8-9-18(20-13-16)21(2)17-6-4-3-5-7-17;/h3-9,13,15,19H,10-12,14H2,1-2H3;1H/t15-;/m1./s1 |
| InChIKey | QOQJYRKXVAPKKU-XFULWGLBSA-N |
| XLogP | 3.07 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |