C11H16IN3 — CID 134406698
(2R)-1-[(6-iodo-3-pyridinyl)methyl]-2-methylpiperazine (PubChem CID 134406698) has the molecular formula C11H16IN3 and a molecular weight of 317.17 g/mol. Its IUPAC name is (2R)-1-[(6-iodo-3-pyridinyl)methyl]-2-methylpiperazine.
| Compound Name | (2R)-1-[(6-iodo-3-pyridinyl)methyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 134406698 |
| Molecular Formula | C11H16IN3 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | (2R)-1-[(6-iodo-3-pyridinyl)methyl]-2-methylpiperazine |
| SMILES | C[C@@H]1CNCCN1Cc1ccc(I)nc1 |
| InChI | InChI=1S/C11H16IN3/c1-9-6-13-4-5-15(9)8-10-2-3-11(12)14-7-10/h2-3,7,9,13H,4-6,8H2,1H3/t9-/m1/s1 |
| InChIKey | QVZGPFVRUFTAJH-SECBINFHSA-N |
| XLogP | 1.48 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|