C20H23ClN4O2 — CID 120840629
4-methyl-3-[3-[4-(morpholin-4-ylmethyl)phenyl]-1,2,4-oxadiazol-5-yl]aniline;hydrochloride (PubChem CID 120840629) has the molecular formula C20H23ClN4O2 and a molecular weight of 386.88 g/mol. Its IUPAC name is 4-methyl-3-[3-[4-(morpholin-4-ylmethyl)phenyl]-1,2,4-oxadiazol-5-yl]aniline;hydrochloride.
| Compound Name | 4-methyl-3-[3-[4-(morpholin-4-ylmethyl)phenyl]-1,2,4-oxadiazol-5-yl]aniline;hydrochloride |
|---|---|
| PubChem CID | 120840629 |
| Molecular Formula | C20H23ClN4O2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 4-methyl-3-[3-[4-(morpholin-4-ylmethyl)phenyl]-1,2,4-oxadiazol-5-yl]aniline;hydrochloride |
| SMILES | Cc1ccc(N)cc1-c1nc(-c2ccc(CN3CCOCC3)cc2)no1.Cl |
| InChI | InChI=1S/C20H22N4O2.ClH/c1-14-2-7-17(21)12-18(14)20-22-19(23-26-20)16-5-3-15(4-6-16)13-24-8-10-25-11-9-24;/h2-7,12H,8-11,13,21H2,1H3;1H |
| InChIKey | VWMZQYOUNLYQNO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|