C21H25ClN4O2 — CID 120840655
2-[2-[3-[4-(morpholin-4-ylmethyl)phenyl]-1,2,4-oxadiazol-5-yl]ethyl]aniline;hydrochloride (PubChem CID 120840655) has the molecular formula C21H25ClN4O2 and a molecular weight of 400.91 g/mol. Its IUPAC name is 2-[2-[3-[4-(morpholin-4-ylmethyl)phenyl]-1,2,4-oxadiazol-5-yl]ethyl]aniline;hydrochloride.
| Compound Name | 2-[2-[3-[4-(morpholin-4-ylmethyl)phenyl]-1,2,4-oxadiazol-5-yl]ethyl]aniline;hydrochloride |
|---|---|
| PubChem CID | 120840655 |
| Molecular Formula | C21H25ClN4O2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-[2-[3-[4-(morpholin-4-ylmethyl)phenyl]-1,2,4-oxadiazol-5-yl]ethyl]aniline;hydrochloride |
| SMILES | Cl.Nc1ccccc1CCc1nc(-c2ccc(CN3CCOCC3)cc2)no1 |
| InChI | InChI=1S/C21H24N4O2.ClH/c22-19-4-2-1-3-17(19)9-10-20-23-21(24-27-20)18-7-5-16(6-8-18)15-25-11-13-26-14-12-25;/h1-8H,9-15,22H2;1H |
| InChIKey | XHQCBSZTPSSRAO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|