C15H29ClN4 — CID 120842604
N-[[1-[(2-propan-2-ylpyrazol-3-yl)methyl]piperidin-4-yl]methyl]ethanamine;hydrochloride (PubChem CID 120842604) has the molecular formula C15H29ClN4 and a molecular weight of 300.88 g/mol. Its IUPAC name is N-[[1-[(2-propan-2-ylpyrazol-3-yl)methyl]piperidin-4-yl]methyl]ethanamine;hydrochloride.
| Compound Name | N-[[1-[(2-propan-2-ylpyrazol-3-yl)methyl]piperidin-4-yl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 120842604 |
| Molecular Formula | C15H29ClN4 |
| Molecular Weight | 300.88 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | N-[[1-[(2-propan-2-ylpyrazol-3-yl)methyl]piperidin-4-yl]methyl]ethanamine;hydrochloride |
| SMILES | CCNCC1CCN(Cc2ccnn2C(C)C)CC1.Cl |
| InChI | InChI=1S/C15H28N4.ClH/c1-4-16-11-14-6-9-18(10-7-14)12-15-5-8-17-19(15)13(2)3;/h5,8,13-14,16H,4,6-7,9-12H2,1-3H3;1H |
| InChIKey | TVMKQZIGTWIFKL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.88 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |