C18H25FN4 — CID 120842641
N-[[1-[[2-(4-fluorophenyl)pyrazol-3-yl]methyl]piperidin-4-yl]methyl]ethanamine (PubChem CID 120842641) has the molecular formula C18H25FN4 and a molecular weight of 316.42 g/mol. Its IUPAC name is N-[[1-[[2-(4-fluorophenyl)pyrazol-3-yl]methyl]piperidin-4-yl]methyl]ethanamine.
| Compound Name | N-[[1-[[2-(4-fluorophenyl)pyrazol-3-yl]methyl]piperidin-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 120842641 |
| Molecular Formula | C18H25FN4 |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | N-[[1-[[2-(4-fluorophenyl)pyrazol-3-yl]methyl]piperidin-4-yl]methyl]ethanamine |
| SMILES | CCNCC1CCN(Cc2ccnn2-c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H25FN4/c1-2-20-13-15-8-11-22(12-9-15)14-18-7-10-21-23(18)17-5-3-16(19)4-6-17/h3-7,10,15,20H,2,8-9,11-14H2,1H3 |
| InChIKey | LIISLIJSSVIWEX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |