C18H28BrClN2O — CID 120849541
N-[(3-bromophenyl)methyl]-N-(piperidin-4-ylmethyl)oxan-4-amine;hydrochloride (PubChem CID 120849541) has the molecular formula C18H28BrClN2O and a molecular weight of 403.79 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-N-(piperidin-4-ylmethyl)oxan-4-amine;hydrochloride.
| Compound Name | N-[(3-bromophenyl)methyl]-N-(piperidin-4-ylmethyl)oxan-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120849541 |
| Molecular Formula | C18H28BrClN2O |
| Molecular Weight | 403.79 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-N-(piperidin-4-ylmethyl)oxan-4-amine;hydrochloride |
| SMILES | Brc1cccc(CN(CC2CCNCC2)C2CCOCC2)c1.Cl |
| InChI | InChI=1S/C18H27BrN2O.ClH/c19-17-3-1-2-16(12-17)14-21(18-6-10-22-11-7-18)13-15-4-8-20-9-5-15;/h1-3,12,15,18,20H,4-11,13-14H2;1H |
| InChIKey | KKZZSWQMICKRPC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.79 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |