C20H22N4O4 — CID 120852858
5-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione (PubChem CID 120852858) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 5-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione.
| Compound Name | 5-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 120852858 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 5-[3-(1-aminocyclopentyl)-1,2,4-oxadiazol-5-yl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione |
| SMILES | NC1(c2noc(-c3ccc4c(c3)C(=O)N(CC3CCCO3)C4=O)n2)CCCC1 |
| InChI | InChI=1S/C20H22N4O4/c21-20(7-1-2-8-20)19-22-16(28-23-19)12-5-6-14-15(10-12)18(26)24(17(14)25)11-13-4-3-9-27-13/h5-6,10,13H,1-4,7-9,11,21H2 |
| InChIKey | YNMWWGXKQQPCJD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|