C18H27FN2O — CID 120853525
(3S)-3-[(2-fluorophenyl)methoxy]-1-(piperidin-4-ylmethyl)piperidine (PubChem CID 120853525) has the molecular formula C18H27FN2O and a molecular weight of 306.42 g/mol. Its IUPAC name is (3S)-3-[(2-fluorophenyl)methoxy]-1-(piperidin-4-ylmethyl)piperidine.
| Compound Name | (3S)-3-[(2-fluorophenyl)methoxy]-1-(piperidin-4-ylmethyl)piperidine |
|---|---|
| PubChem CID | 120853525 |
| Molecular Formula | C18H27FN2O |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (3S)-3-[(2-fluorophenyl)methoxy]-1-(piperidin-4-ylmethyl)piperidine |
| SMILES | Fc1ccccc1CO[C@H]1CCCN(CC2CCNCC2)C1 |
| InChI | InChI=1S/C18H27FN2O/c19-18-6-2-1-4-16(18)14-22-17-5-3-11-21(13-17)12-15-7-9-20-10-8-15/h1-2,4,6,15,17,20H,3,5,7-14H2/t17-/m0/s1 |
| InChIKey | HISJXRYYEAGECP-KRWDZBQOSA-N |
| XLogP | 2.81 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |