C22H27N3O — CID 120854870
(4aR,7aS)-4-benzyl-6-(2,3-dihydro-1H-indol-7-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 120854870) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is (4aR,7aS)-4-benzyl-6-(2,3-dihydro-1H-indol-7-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aR,7aS)-4-benzyl-6-(2,3-dihydro-1H-indol-7-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 120854870 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | (4aR,7aS)-4-benzyl-6-(2,3-dihydro-1H-indol-7-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | c1ccc(CN2CCO[C@H]3CN(Cc4cccc5c4NCC5)C[C@H]32)cc1 |
| InChI | InChI=1S/C22H27N3O/c1-2-5-17(6-3-1)13-25-11-12-26-21-16-24(15-20(21)25)14-19-8-4-7-18-9-10-23-22(18)19/h1-8,20-21,23H,9-16H2/t20-,21+/m1/s1 |
| InChIKey | ACLXQNWJNPTXPD-RTWAWAEBSA-N |
| XLogP | 2.74 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |