C13H24N2O2 — CID 120855430
6-(piperidin-3-ylmethyl)-2,9-dioxa-6-azaspiro[4.5]decane (PubChem CID 120855430) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 6-(piperidin-3-ylmethyl)-2,9-dioxa-6-azaspiro[4.5]decane.
| Compound Name | 6-(piperidin-3-ylmethyl)-2,9-dioxa-6-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 120855430 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 6-(piperidin-3-ylmethyl)-2,9-dioxa-6-azaspiro[4.5]decane |
| SMILES | C1CNCC(CN2CCOCC23CCOC3)C1 |
| InChI | InChI=1S/C13H24N2O2/c1-2-12(8-14-4-1)9-15-5-7-17-11-13(15)3-6-16-10-13/h12,14H,1-11H2 |
| InChIKey | PNOKSHCQPATTPE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |