C17H29ClN4 — CID 120858421
3-(2-methylpyrazol-3-yl)-8-(piperidin-3-ylmethyl)-8-azabicyclo[3.2.1]octane;hydrochloride (PubChem CID 120858421) has the molecular formula C17H29ClN4 and a molecular weight of 324.90 g/mol. Its IUPAC name is 3-(2-methylpyrazol-3-yl)-8-(piperidin-3-ylmethyl)-8-azabicyclo[3.2.1]octane;hydrochloride.
| Compound Name | 3-(2-methylpyrazol-3-yl)-8-(piperidin-3-ylmethyl)-8-azabicyclo[3.2.1]octane;hydrochloride |
|---|---|
| PubChem CID | 120858421 |
| Molecular Formula | C17H29ClN4 |
| Molecular Weight | 324.90 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 3-(2-methylpyrazol-3-yl)-8-(piperidin-3-ylmethyl)-8-azabicyclo[3.2.1]octane;hydrochloride |
| SMILES | Cl.Cn1nccc1C1CC2CCC(C1)N2CC1CCCNC1 |
| InChI | InChI=1S/C17H28N4.ClH/c1-20-17(6-8-19-20)14-9-15-4-5-16(10-14)21(15)12-13-3-2-7-18-11-13;/h6,8,13-16,18H,2-5,7,9-12H2,1H3;1H |
| InChIKey | JCYKJJREEBRPIN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.90 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |