C12H24ClN5O2S — CID 120871028
N-[2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]ethyl]ethanesulfonamide;hydrochloride (PubChem CID 120871028) has the molecular formula C12H24ClN5O2S and a molecular weight of 337.88 g/mol. Its IUPAC name is N-[2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]ethyl]ethanesulfonamide;hydrochloride.
| Compound Name | N-[2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]ethyl]ethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120871028 |
| Molecular Formula | C12H24ClN5O2S |
| Molecular Weight | 337.88 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-[2-[2-(1-methylimidazol-2-yl)piperazin-1-yl]ethyl]ethanesulfonamide;hydrochloride |
| SMILES | CCS(=O)(=O)NCCN1CCNCC1c1nccn1C.Cl |
| InChI | InChI=1S/C12H23N5O2S.ClH/c1-3-20(18,19)15-6-9-17-8-4-13-10-11(17)12-14-5-7-16(12)2;/h5,7,11,13,15H,3-4,6,8-10H2,1-2H3;1H |
| InChIKey | JFDSKXBRJAREBV-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.88 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |